C21H20N4S — CID 136781941
4-(3,4-dimethylphenyl)-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,3-thiazol-2-amine (PubChem CID 136781941) has the molecular formula C21H20N4S and a molecular weight of 360.49 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(3,4-dimethylphenyl)-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 136781941 |
| Molecular Formula | C21H20N4S |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(-c2csc(N/N=C\c3c(C)[nH]c4ccccc34)n2)cc1C |
| InChI | InChI=1S/C21H20N4S/c1-13-8-9-16(10-14(13)2)20-12-26-21(24-20)25-22-11-18-15(3)23-19-7-5-4-6-17(18)19/h4-12,23H,1-3H3,(H,24,25)/b22-11- |
| InChIKey | HLYZITXSLLWZOV-JJFYIABZSA-N |
| XLogP | 5.66 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|