C23H20ClN3OS — CID 17384637
N-[(E)-[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4,5-dimethyl-1,3-thiazol-2-amine (PubChem CID 17384637) has the molecular formula C23H20ClN3OS and a molecular weight of 421.95 g/mol. Its IUPAC name is N-[(E)-[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4,5-dimethyl-1,3-thiazol-2-amine.
| Compound Name | N-[(E)-[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4,5-dimethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 17384637 |
| Molecular Formula | C23H20ClN3OS |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-[(E)-[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4,5-dimethyl-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N/N=C/c2c(OCc3ccccc3Cl)ccc3ccccc23)sc1C |
| InChI | InChI=1S/C23H20ClN3OS/c1-15-16(2)29-23(26-15)27-25-13-20-19-9-5-3-7-17(19)11-12-22(20)28-14-18-8-4-6-10-21(18)24/h3-13H,14H2,1-2H3,(H,26,27)/b25-13+ |
| InChIKey | NRLSRFARKNWWQV-DHRITJCHSA-N |
| XLogP | 6.59 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|