C19H19Cl2N3OS — CID 171151073
N-[[2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-4,5-dimethyl-1,3-thiazol-2-amine;hydrochloride (PubChem CID 171151073) has the molecular formula C19H19Cl2N3OS and a molecular weight of 408.35 g/mol. Its IUPAC name is N-[[2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-4,5-dimethyl-1,3-thiazol-2-amine;hydrochloride.
| Compound Name | N-[[2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-4,5-dimethyl-1,3-thiazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 171151073 |
| Molecular Formula | C19H19Cl2N3OS |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | N-[[2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-4,5-dimethyl-1,3-thiazol-2-amine;hydrochloride |
| SMILES | Cc1nc(NN=Cc2ccccc2OCc2ccc(Cl)cc2)sc1C.Cl |
| InChI | InChI=1S/C19H18ClN3OS.ClH/c1-13-14(2)25-19(22-13)23-21-11-16-5-3-4-6-18(16)24-12-15-7-9-17(20)10-8-15;/h3-11H,12H2,1-2H3,(H,22,23);1H |
| InChIKey | VRRFIDCCTQLPQN-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|