C18H16ClN5O2 — CID 71966470
5-[2-[[2-[(4-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-6-methyl-2H-1,2,4-triazin-3-one (PubChem CID 71966470) has the molecular formula C18H16ClN5O2 and a molecular weight of 369.81 g/mol. Its IUPAC name is 5-[2-[[2-[(4-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-6-methyl-2H-1,2,4-triazin-3-one.
| Compound Name | 5-[2-[[2-[(4-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-6-methyl-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 71966470 |
| Molecular Formula | C18H16ClN5O2 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 5-[2-[[2-[(4-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-6-methyl-2H-1,2,4-triazin-3-one |
| SMILES | Cc1n[nH]c(=O)nc1NN=Cc1ccccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClN5O2/c1-12-17(21-18(25)24-22-12)23-20-10-14-4-2-3-5-16(14)26-11-13-6-8-15(19)9-7-13/h2-10H,11H2,1H3,(H2,21,23,24,25) |
| InChIKey | CYMFJUKGXUEJLD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|