C22H20N8 — CID 137045142
N,4-bis[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,2,4-triazol-3-amine (PubChem CID 137045142) has the molecular formula C22H20N8 and a molecular weight of 396.46 g/mol. Its IUPAC name is N,4-bis[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,2,4-triazol-3-amine.
| Compound Name | N,4-bis[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 137045142 |
| Molecular Formula | C22H20N8 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N,4-bis[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,2,4-triazol-3-amine |
| SMILES | Cc1[nH]c2ccccc2c1/C=N\Nc1nncn1/N=C\c1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C22H20N8/c1-14-18(16-7-3-5-9-20(16)26-14)11-23-28-22-29-24-13-30(22)25-12-19-15(2)27-21-10-6-4-8-17(19)21/h3-13,26-27H,1-2H3,(H,28,29)/b23-11-,25-12- |
| InChIKey | KGJDCCYHCWOEOA-AJMGHOAOSA-N |
| XLogP | 4.19 |
| TPSA | 99.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|