C24H24N8 — CID 137089234
5-ethyl-N,4-bis[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,2,4-triazol-3-amine (PubChem CID 137089234) has the molecular formula C24H24N8 and a molecular weight of 424.51 g/mol. Its IUPAC name is 5-ethyl-N,4-bis[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,2,4-triazol-3-amine.
| Compound Name | 5-ethyl-N,4-bis[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 137089234 |
| Molecular Formula | C24H24N8 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 5-ethyl-N,4-bis[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,2,4-triazol-3-amine |
| SMILES | CCc1nnc(N/N=C\c2c(C)[nH]c3ccccc23)n1/N=C\c1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C24H24N8/c1-4-23-29-31-24(30-25-13-19-15(2)27-21-11-7-5-9-17(19)21)32(23)26-14-20-16(3)28-22-12-8-6-10-18(20)22/h5-14,27-28H,4H2,1-3H3,(H,30,31)/b25-13-,26-14- |
| InChIKey | DSDXZARTDKERBP-WFBNZKAHSA-N |
| XLogP | 4.75 |
| TPSA | 99.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|