C20H24N8 — CID 21214266
N-[[4-(dimethylamino)phenyl]methylideneamino]-4-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-1,2,4-triazol-3-amine (PubChem CID 21214266) has the molecular formula C20H24N8 and a molecular weight of 376.47 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methylideneamino]-4-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-1,2,4-triazol-3-amine.
| Compound Name | N-[[4-(dimethylamino)phenyl]methylideneamino]-4-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 21214266 |
| Molecular Formula | C20H24N8 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methylideneamino]-4-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-1,2,4-triazol-3-amine |
| SMILES | CN(C)c1ccc(C=NNc2nncn2/N=C/c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H24N8/c1-26(2)18-9-5-16(6-10-18)13-21-24-20-25-22-15-28(20)23-14-17-7-11-19(12-8-17)27(3)4/h5-15H,1-4H3,(H,24,25)/b21-13?,23-14+ |
| InChIKey | YMGIGUSVLSDZPP-KIWLYEELSA-N |
| XLogP | 2.74 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|