C12H15N5S — CID 6380909
N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-5-methyl-1,3,4-thiadiazol-2-amine (PubChem CID 6380909) has the molecular formula C12H15N5S and a molecular weight of 261.35 g/mol. Its IUPAC name is N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-5-methyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-5-methyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 6380909 |
| Molecular Formula | C12H15N5S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-5-methyl-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1nnc(N/N=C\c2ccc(N(C)C)cc2)s1 |
| InChI | InChI=1S/C12H15N5S/c1-9-14-16-12(18-9)15-13-8-10-4-6-11(7-5-10)17(2)3/h4-8H,1-3H3,(H,15,16)/b13-8- |
| InChIKey | YVKLNBLKZOQORS-JYRVWZFOSA-N |
| XLogP | 2.36 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|