C10H10N4O2S — CID 4639041
4-[[(5-methyl-1,3,4-thiadiazol-2-yl)hydrazinylidene]methyl]benzene-1,3-diol (PubChem CID 4639041) has the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. Its IUPAC name is 4-[[(5-methyl-1,3,4-thiadiazol-2-yl)hydrazinylidene]methyl]benzene-1,3-diol.
| Compound Name | 4-[[(5-methyl-1,3,4-thiadiazol-2-yl)hydrazinylidene]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 4639041 |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 4-[[(5-methyl-1,3,4-thiadiazol-2-yl)hydrazinylidene]methyl]benzene-1,3-diol |
| SMILES | Cc1nnc(NN=Cc2ccc(O)cc2O)s1 |
| InChI | InChI=1S/C10H10N4O2S/c1-6-12-14-10(17-6)13-11-5-7-2-3-8(15)4-9(7)16/h2-5,15-16H,1H3,(H,13,14) |
| InChIKey | XUPIKTSABQTWFF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|