C21H17N7 — CID 135699371
N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-1-phenylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 135699371) has the molecular formula C21H17N7 and a molecular weight of 367.42 g/mol. Its IUPAC name is N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-1-phenylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-1-phenylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 135699371 |
| Molecular Formula | C21H17N7 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-1-phenylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cc1[nH]c2ccccc2c1/C=N/Nc1ncnc2c1cnn2-c1ccccc1 |
| InChI | InChI=1S/C21H17N7/c1-14-17(16-9-5-6-10-19(16)26-14)11-24-27-20-18-12-25-28(21(18)23-13-22-20)15-7-3-2-4-8-15/h2-13,26H,1H3,(H,22,23,27)/b24-11+ |
| InChIKey | QSVYPHVMLNSRIM-BHGWPJFGSA-N |
| XLogP | 4.05 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|