C18H15N7O — CID 78416977
1-(4-methoxyphenyl)-N-(pyridin-4-ylmethylideneamino)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 78416977) has the molecular formula C18H15N7O and a molecular weight of 345.37 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-(pyridin-4-ylmethylideneamino)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-(4-methoxyphenyl)-N-(pyridin-4-ylmethylideneamino)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 78416977 |
| Molecular Formula | C18H15N7O |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-(pyridin-4-ylmethylideneamino)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | COc1ccc(-n2ncc3c(NN=Cc4ccncc4)ncnc32)cc1 |
| InChI | InChI=1S/C18H15N7O/c1-26-15-4-2-14(3-5-15)25-18-16(11-23-25)17(20-12-21-18)24-22-10-13-6-8-19-9-7-13/h2-12H,1H3,(H,20,21,24) |
| InChIKey | XJTYMXROKHFETH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|