C20H18N6O3 — CID 72636247
2,3-dimethoxy-5-[[(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol (PubChem CID 72636247) has the molecular formula C20H18N6O3 and a molecular weight of 390.40 g/mol. Its IUPAC name is 2,3-dimethoxy-5-[[(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2,3-dimethoxy-5-[[(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 72636247 |
| Molecular Formula | C20H18N6O3 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 2,3-dimethoxy-5-[[(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol |
| SMILES | COc1cc(C=NNc2ncnc3c2cnn3-c2ccccc2)cc(O)c1OC |
| InChI | InChI=1S/C20H18N6O3/c1-28-17-9-13(8-16(27)18(17)29-2)10-23-25-19-15-11-24-26(20(15)22-12-21-19)14-6-4-3-5-7-14/h3-12,27H,1-2H3,(H,21,22,25) |
| InChIKey | COFNWPVXKHWSPR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|