C18H12Br2N6O — CID 135873537
2,4-dibromo-6-[(Z)-[(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol (PubChem CID 135873537) has the molecular formula C18H12Br2N6O and a molecular weight of 488.14 g/mol. Its IUPAC name is 2,4-dibromo-6-[(Z)-[(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dibromo-6-[(Z)-[(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135873537 |
| Molecular Formula | C18H12Br2N6O |
| Molecular Weight | 488.14 g/mol |
| Exact Mass | 485.94 |
| IUPAC Name | 2,4-dibromo-6-[(Z)-[(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol |
| SMILES | Oc1c(Br)cc(Br)cc1/C=N\Nc1ncnc2c1cnn2-c1ccccc1 |
| InChI | InChI=1S/C18H12Br2N6O/c19-12-6-11(16(27)15(20)7-12)8-23-25-17-14-9-24-26(18(14)22-10-21-17)13-4-2-1-3-5-13/h1-10,27H,(H,21,22,25)/b23-8- |
| InChIKey | DYMAONZNLPETFV-NYAPKIOYSA-N |
| XLogP | 4.49 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.14 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|