C17H10Br2N4O2 — CID 135684918
2-[(E)-([1]benzofuro[3,2-d]pyrimidin-4-ylhydrazinylidene)methyl]-4,6-dibromophenol (PubChem CID 135684918) has the molecular formula C17H10Br2N4O2 and a molecular weight of 462.10 g/mol. Its IUPAC name is 2-[(E)-([1]benzofuro[3,2-d]pyrimidin-4-ylhydrazinylidene)methyl]-4,6-dibromophenol.
| Compound Name | 2-[(E)-([1]benzofuro[3,2-d]pyrimidin-4-ylhydrazinylidene)methyl]-4,6-dibromophenol |
|---|---|
| PubChem CID | 135684918 |
| Molecular Formula | C17H10Br2N4O2 |
| Molecular Weight | 462.10 g/mol |
| Exact Mass | 459.92 |
| IUPAC Name | 2-[(E)-([1]benzofuro[3,2-d]pyrimidin-4-ylhydrazinylidene)methyl]-4,6-dibromophenol |
| SMILES | Oc1c(Br)cc(Br)cc1/C=N/Nc1ncnc2c1oc1ccccc12 |
| InChI | InChI=1S/C17H10Br2N4O2/c18-10-5-9(15(24)12(19)6-10)7-22-23-17-16-14(20-8-21-17)11-3-1-2-4-13(11)25-16/h1-8,24H,(H,20,21,23)/b22-7+ |
| InChIKey | BLHIDWGGYSDCDT-QPJQQBGISA-N |
| XLogP | 5.05 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.10 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|