C19H16N4O2 — CID 9397520
N-[(Z)-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-[1]benzofuro[3,2-d]pyrimidin-4-amine (PubChem CID 9397520) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is N-[(Z)-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-[1]benzofuro[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[(Z)-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-[1]benzofuro[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 9397520 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-[(Z)-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-[1]benzofuro[3,2-d]pyrimidin-4-amine |
| SMILES | C[C@H]1C[C@@H]1c1ccc(/C=N\Nc2ncnc3c2oc2ccccc23)o1 |
| InChI | InChI=1S/C19H16N4O2/c1-11-8-14(11)16-7-6-12(24-16)9-22-23-19-18-17(20-10-21-19)13-4-2-3-5-15(13)25-18/h2-7,9-11,14H,8H2,1H3,(H,20,21,23)/b22-9-/t11-,14-/m0/s1 |
| InChIKey | XXFPVLQIJYHKOL-CKYSNWAJSA-N |
| XLogP | 4.54 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|