C20H16F2N4O3 — CID 9300369
N-[(Z)-[2-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-[1]benzofuro[3,2-d]pyrimidin-4-amine (PubChem CID 9300369) has the molecular formula C20H16F2N4O3 and a molecular weight of 398.37 g/mol. Its IUPAC name is N-[(Z)-[2-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-[1]benzofuro[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[(Z)-[2-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-[1]benzofuro[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 9300369 |
| Molecular Formula | C20H16F2N4O3 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N-[(Z)-[2-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-[1]benzofuro[3,2-d]pyrimidin-4-amine |
| SMILES | CCOc1cccc(/C=N\Nc2ncnc3c2oc2ccccc23)c1OC(F)F |
| InChI | InChI=1S/C20H16F2N4O3/c1-2-27-15-9-5-6-12(17(15)29-20(21)22)10-25-26-19-18-16(23-11-24-19)13-7-3-4-8-14(13)28-18/h3-11,20H,2H2,1H3,(H,23,24,26)/b25-10- |
| InChIKey | OQAFEHPDRPPPMH-MRUKODCESA-N |
| XLogP | 4.82 |
| TPSA | 81.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|