C17H18N4O — CID 9023435
N-[[(2R)-2-methylcyclohexylidene]amino]-[1]benzofuro[3,2-d]pyrimidin-4-amine (PubChem CID 9023435) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is N-[[(2R)-2-methylcyclohexylidene]amino]-[1]benzofuro[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[[(2R)-2-methylcyclohexylidene]amino]-[1]benzofuro[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 9023435 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N-[[(2R)-2-methylcyclohexylidene]amino]-[1]benzofuro[3,2-d]pyrimidin-4-amine |
| SMILES | C[C@@H]1CCCCC1=NNc1ncnc2c1oc1ccccc12 |
| InChI | InChI=1S/C17H18N4O/c1-11-6-2-4-8-13(11)20-21-17-16-15(18-10-19-17)12-7-3-5-9-14(12)22-16/h3,5,7,9-11H,2,4,6,8H2,1H3,(H,18,19,21)/t11-/m1/s1 |
| InChIKey | VUESYAYALUFGBQ-LLVKDONJSA-N |
| XLogP | 4.35 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|