C15H12Br2N4OS — CID 3601514
2,4-dibromo-6-[[(6-ethylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol (PubChem CID 3601514) has the molecular formula C15H12Br2N4OS and a molecular weight of 456.16 g/mol. Its IUPAC name is 2,4-dibromo-6-[[(6-ethylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dibromo-6-[[(6-ethylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 3601514 |
| Molecular Formula | C15H12Br2N4OS |
| Molecular Weight | 456.16 g/mol |
| Exact Mass | 453.91 |
| IUPAC Name | 2,4-dibromo-6-[[(6-ethylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol |
| SMILES | CCc1cc2c(NN=Cc3cc(Br)cc(Br)c3O)ncnc2s1 |
| InChI | InChI=1S/C15H12Br2N4OS/c1-2-10-5-11-14(18-7-19-15(11)23-10)21-20-6-8-3-9(16)4-12(17)13(8)22/h3-7,22H,2H2,1H3,(H,18,19,21) |
| InChIKey | WEZUBQSMEJJAHA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.16 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|