C11H9Br2N5O2S — CID 135821997
N-[5-[(2E)-2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 135821997) has the molecular formula C11H9Br2N5O2S and a molecular weight of 435.10 g/mol. Its IUPAC name is N-[5-[(2E)-2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[(2E)-2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 135821997 |
| Molecular Formula | C11H9Br2N5O2S |
| Molecular Weight | 435.10 g/mol |
| Exact Mass | 432.88 |
| IUPAC Name | N-[5-[(2E)-2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(N/N=C/c2cc(Br)cc(Br)c2O)s1 |
| InChI | InChI=1S/C11H9Br2N5O2S/c1-5(19)15-10-17-18-11(21-10)16-14-4-6-2-7(12)3-8(13)9(6)20/h2-4,20H,1H3,(H,16,18)(H,15,17,19)/b14-4+ |
| InChIKey | UVLZQFLQGXGNID-LNKIKWGQSA-N |
| XLogP | 3.17 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.10 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|