C9H7Br2N5OS — CID 136688463
5-[(2Z)-2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 136688463) has the molecular formula C9H7Br2N5OS and a molecular weight of 393.06 g/mol. Its IUPAC name is 5-[(2Z)-2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[(2Z)-2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 136688463 |
| Molecular Formula | C9H7Br2N5OS |
| Molecular Weight | 393.06 g/mol |
| Exact Mass | 390.87 |
| IUPAC Name | 5-[(2Z)-2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | Oc1c(Br)cc(Br)cc1/C=N\Nc1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C9H7Br2N5OS/c10-5-1-4(7(17)6(11)2-5)3-12-14-8-13-9(18)16-15-8/h1-3,17H,(H3,13,14,15,16,18)/b12-3- |
| InChIKey | XVKMTTHIYITUPJ-BASWHVEKSA-N |
| XLogP | 3.14 |
| TPSA | 89.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.06 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|