C16H11Br2N3O — CID 3093103
2,4-dibromo-6-[(quinolin-8-ylhydrazinylidene)methyl]phenol (PubChem CID 3093103) has the molecular formula C16H11Br2N3O and a molecular weight of 421.09 g/mol. Its IUPAC name is 2,4-dibromo-6-[(quinolin-8-ylhydrazinylidene)methyl]phenol.
| Compound Name | 2,4-dibromo-6-[(quinolin-8-ylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 3093103 |
| Molecular Formula | C16H11Br2N3O |
| Molecular Weight | 421.09 g/mol |
| Exact Mass | 418.93 |
| IUPAC Name | 2,4-dibromo-6-[(quinolin-8-ylhydrazinylidene)methyl]phenol |
| SMILES | Oc1c(Br)cc(Br)cc1C=NNc1cccc2cccnc12 |
| InChI | InChI=1S/C16H11Br2N3O/c17-12-7-11(16(22)13(18)8-12)9-20-21-14-5-1-3-10-4-2-6-19-15(10)14/h1-9,21-22H |
| InChIKey | JXUBXAVUEGJYCE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.09 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|