C24H29N3O — CID 136718416
3,5-ditert-butyl-2-[(Z)-(quinolin-8-ylhydrazinylidene)methyl]phenol (PubChem CID 136718416) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is 3,5-ditert-butyl-2-[(Z)-(quinolin-8-ylhydrazinylidene)methyl]phenol.
| Compound Name | 3,5-ditert-butyl-2-[(Z)-(quinolin-8-ylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 136718416 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 3,5-ditert-butyl-2-[(Z)-(quinolin-8-ylhydrazinylidene)methyl]phenol |
| SMILES | CC(C)(C)c1cc(O)c(/C=N\Nc2cccc3cccnc23)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H29N3O/c1-23(2,3)17-13-19(24(4,5)6)18(21(28)14-17)15-26-27-20-11-7-9-16-10-8-12-25-22(16)20/h7-15,27-28H,1-6H3/b26-15- |
| InChIKey | BZGFOTCNZKAUFP-YSMPRRRNSA-N |
| XLogP | 5.98 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|