C19H15Br2N3O3 — CID 136909081
(2S)-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-quinolin-8-yloxypropanamide (PubChem CID 136909081) has the molecular formula C19H15Br2N3O3 and a molecular weight of 493.16 g/mol. Its IUPAC name is (2S)-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-quinolin-8-yloxypropanamide.
| Compound Name | (2S)-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-quinolin-8-yloxypropanamide |
|---|---|
| PubChem CID | 136909081 |
| Molecular Formula | C19H15Br2N3O3 |
| Molecular Weight | 493.16 g/mol |
| Exact Mass | 490.95 |
| IUPAC Name | (2S)-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-quinolin-8-yloxypropanamide |
| SMILES | C[C@H](Oc1cccc2cccnc12)C(=O)N/N=C\c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C19H15Br2N3O3/c1-11(27-16-6-2-4-12-5-3-7-22-17(12)16)19(26)24-23-10-13-8-14(20)9-15(21)18(13)25/h2-11,25H,1H3,(H,24,26)/b23-10-/t11-/m0/s1 |
| InChIKey | JELODXVBFPGHAV-ASDNRQTRSA-N |
| XLogP | 4.38 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.16 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|