C20H17N3O4 — CID 5436399
(2R)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-quinolin-8-yloxypropanamide (PubChem CID 5436399) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is (2R)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-quinolin-8-yloxypropanamide.
| Compound Name | (2R)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-quinolin-8-yloxypropanamide |
|---|---|
| PubChem CID | 5436399 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (2R)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-quinolin-8-yloxypropanamide |
| SMILES | C[C@@H](Oc1cccc2cccnc12)C(=O)N/N=C\c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H17N3O4/c1-13(27-17-6-2-4-15-5-3-9-21-19(15)17)20(24)23-22-11-14-7-8-16-18(10-14)26-12-25-16/h2-11,13H,12H2,1H3,(H,23,24)/b22-11-/t13-/m1/s1 |
| InChIKey | TWIOQZWYENBSIJ-MYSNOUKZSA-N |
| XLogP | 2.88 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|