C16H9Br2Cl2N3O2 — CID 4566140
5,7-dichloro-2-[2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]quinolin-8-ol (PubChem CID 4566140) has the molecular formula C16H9Br2Cl2N3O2 and a molecular weight of 505.98 g/mol. Its IUPAC name is 5,7-dichloro-2-[2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]quinolin-8-ol.
| Compound Name | 5,7-dichloro-2-[2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]quinolin-8-ol |
|---|---|
| PubChem CID | 4566140 |
| Molecular Formula | C16H9Br2Cl2N3O2 |
| Molecular Weight | 505.98 g/mol |
| Exact Mass | 502.84 |
| IUPAC Name | 5,7-dichloro-2-[2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]quinolin-8-ol |
| SMILES | Oc1c(Br)cc(Br)cc1C=NNc1ccc2c(Cl)cc(Cl)c(O)c2n1 |
| InChI | InChI=1S/C16H9Br2Cl2N3O2/c17-8-3-7(15(24)10(18)4-8)6-21-23-13-2-1-9-11(19)5-12(20)16(25)14(9)22-13/h1-6,24-25H,(H,22,23) |
| InChIKey | AKTKCWWEZTUKHC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.98 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|