C17H13Cl2N3O3 — CID 135606477
5,7-dichloro-2-[(2E)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]quinolin-8-ol (PubChem CID 135606477) has the molecular formula C17H13Cl2N3O3 and a molecular weight of 378.22 g/mol. Its IUPAC name is 5,7-dichloro-2-[(2E)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]quinolin-8-ol.
| Compound Name | 5,7-dichloro-2-[(2E)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]quinolin-8-ol |
|---|---|
| PubChem CID | 135606477 |
| Molecular Formula | C17H13Cl2N3O3 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 5,7-dichloro-2-[(2E)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]quinolin-8-ol |
| SMILES | COc1cccc(/C=N/Nc2ccc3c(Cl)cc(Cl)c(O)c3n2)c1O |
| InChI | InChI=1S/C17H13Cl2N3O3/c1-25-13-4-2-3-9(16(13)23)8-20-22-14-6-5-10-11(18)7-12(19)17(24)15(10)21-14/h2-8,23-24H,1H3,(H,21,22)/b20-8+ |
| InChIKey | CBJIXQCZPHXPAQ-DNTJNYDQSA-N |
| XLogP | 4.41 |
| TPSA | 86.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|