C19H17N7O2 — CID 77313057
1-(3-methoxyphenyl)-N-[(2-methoxy-4-pyridinyl)methylideneamino]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 77313057) has the molecular formula C19H17N7O2 and a molecular weight of 375.39 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-N-[(2-methoxy-4-pyridinyl)methylideneamino]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-(3-methoxyphenyl)-N-[(2-methoxy-4-pyridinyl)methylideneamino]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 77313057 |
| Molecular Formula | C19H17N7O2 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 1-(3-methoxyphenyl)-N-[(2-methoxy-4-pyridinyl)methylideneamino]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | COc1cccc(-n2ncc3c(NN=Cc4ccnc(OC)c4)ncnc32)c1 |
| InChI | InChI=1S/C19H17N7O2/c1-27-15-5-3-4-14(9-15)26-19-16(11-24-26)18(21-12-22-19)25-23-10-13-6-7-20-17(8-13)28-2/h3-12H,1-2H3,(H,21,22,25) |
| InChIKey | KVHUWFXNZLZAFR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|