C20H19N7 — CID 3741959
N-[[4-(dimethylamino)phenyl]methylideneamino]-1-phenylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 3741959) has the molecular formula C20H19N7 and a molecular weight of 357.42 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methylideneamino]-1-phenylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | N-[[4-(dimethylamino)phenyl]methylideneamino]-1-phenylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 3741959 |
| Molecular Formula | C20H19N7 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methylideneamino]-1-phenylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CN(C)c1ccc(C=NNc2ncnc3c2cnn3-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H19N7/c1-26(2)16-10-8-15(9-11-16)12-23-25-19-18-13-24-27(20(18)22-14-21-19)17-6-4-3-5-7-17/h3-14H,1-2H3,(H,21,22,25) |
| InChIKey | YFYCIDBYRQDLPP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 71.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|