C19H15ClN6 — CID 6159961
N-[(Z)-(4-chlorophenyl)methylideneamino]-6-methyl-1-phenylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 6159961) has the molecular formula C19H15ClN6 and a molecular weight of 362.82 g/mol. Its IUPAC name is N-[(Z)-(4-chlorophenyl)methylideneamino]-6-methyl-1-phenylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | N-[(Z)-(4-chlorophenyl)methylideneamino]-6-methyl-1-phenylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 6159961 |
| Molecular Formula | C19H15ClN6 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | N-[(Z)-(4-chlorophenyl)methylideneamino]-6-methyl-1-phenylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cc1nc(N/N=C\c2ccc(Cl)cc2)c2cnn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C19H15ClN6/c1-13-23-18(25-21-11-14-7-9-15(20)10-8-14)17-12-22-26(19(17)24-13)16-5-3-2-4-6-16/h2-12H,1H3,(H,23,24,25)/b21-11- |
| InChIKey | BBWLNMFBJPIISY-NHDPSOOVSA-N |
| XLogP | 4.22 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|