C10H13ClN6O — CID 136666616
2-[[(4-amino-5-methyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]phenol;hydrochloride (PubChem CID 136666616) has the molecular formula C10H13ClN6O and a molecular weight of 268.71 g/mol. Its IUPAC name is 2-[[(4-amino-5-methyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]phenol;hydrochloride.
| Compound Name | 2-[[(4-amino-5-methyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 136666616 |
| Molecular Formula | C10H13ClN6O |
| Molecular Weight | 268.71 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-[[(4-amino-5-methyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]phenol;hydrochloride |
| SMILES | Cc1nnc(NN=Cc2ccccc2O)n1N.Cl |
| InChI | InChI=1S/C10H12N6O.ClH/c1-7-13-15-10(16(7)11)14-12-6-8-4-2-3-5-9(8)17;/h2-6,17H,11H2,1H3,(H,14,15);1H |
| InChIKey | SENRXZAWMTYSOZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.71 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|