C10H10ClFN6 — CID 6293419
3-N-[(Z)-(5-chloro-2-fluorophenyl)methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine (PubChem CID 6293419) has the molecular formula C10H10ClFN6 and a molecular weight of 268.68 g/mol. Its IUPAC name is 3-N-[(Z)-(5-chloro-2-fluorophenyl)methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-[(Z)-(5-chloro-2-fluorophenyl)methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 6293419 |
| Molecular Formula | C10H10ClFN6 |
| Molecular Weight | 268.68 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 3-N-[(Z)-(5-chloro-2-fluorophenyl)methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine |
| SMILES | Cc1nnc(N/N=C\c2cc(Cl)ccc2F)n1N |
| InChI | InChI=1S/C10H10ClFN6/c1-6-15-17-10(18(6)13)16-14-5-7-4-8(11)2-3-9(7)12/h2-5H,13H2,1H3,(H,16,17)/b14-5- |
| InChIKey | WZUBHHZUACIBDD-RZNTYIFUSA-N |
| XLogP | 1.54 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.68 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|