C13H13FN8 — CID 136726451
3-N-[(Z)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine (PubChem CID 136726451) has the molecular formula C13H13FN8 and a molecular weight of 300.30 g/mol. Its IUPAC name is 3-N-[(Z)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-[(Z)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 136726451 |
| Molecular Formula | C13H13FN8 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 3-N-[(Z)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine |
| SMILES | Cc1nnc(N/N=C\c2cn[nH]c2-c2ccc(F)cc2)n1N |
| InChI | InChI=1S/C13H13FN8/c1-8-18-21-13(22(8)15)20-17-7-10-6-16-19-12(10)9-2-4-11(14)5-3-9/h2-7H,15H2,1H3,(H,16,19)(H,20,21)/b17-7- |
| InChIKey | PWYAZAJWSUUKLW-IDUWFGFVSA-N |
| XLogP | 1.28 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|