C11H14N6S — CID 6393141
5-methyl-3-N-[(Z)-(4-methylsulfanylphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine (PubChem CID 6393141) has the molecular formula C11H14N6S and a molecular weight of 262.34 g/mol. Its IUPAC name is 5-methyl-3-N-[(Z)-(4-methylsulfanylphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-methyl-3-N-[(Z)-(4-methylsulfanylphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 6393141 |
| Molecular Formula | C11H14N6S |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 5-methyl-3-N-[(Z)-(4-methylsulfanylphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine |
| SMILES | CSc1ccc(/C=N\Nc2nnc(C)n2N)cc1 |
| InChI | InChI=1S/C11H14N6S/c1-8-14-16-11(17(8)12)15-13-7-9-3-5-10(18-2)6-4-9/h3-7H,12H2,1-2H3,(H,15,16)/b13-7- |
| InChIKey | YSMVKGJRSQFPDL-QPEQYQDCSA-N |
| XLogP | 1.47 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|