C12H16BrN7 — CID 3304306
3-N-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine (PubChem CID 3304306) has the molecular formula C12H16BrN7 and a molecular weight of 338.21 g/mol. Its IUPAC name is 3-N-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 3304306 |
| Molecular Formula | C12H16BrN7 |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 3-N-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine |
| SMILES | Cc1nnc(NN=Cc2ccc(N(C)C)c(Br)c2)n1N |
| InChI | InChI=1S/C12H16BrN7/c1-8-16-18-12(20(8)14)17-15-7-9-4-5-11(19(2)3)10(13)6-9/h4-7H,14H2,1-3H3,(H,17,18) |
| InChIKey | LBIYFVPNVXVVBV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 84.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|