C17H18BrN3O — CID 19060941
N-[(E)-[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-2-methylbenzamide (PubChem CID 19060941) has the molecular formula C17H18BrN3O and a molecular weight of 360.26 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-2-methylbenzamide.
| Compound Name | N-[(E)-[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-2-methylbenzamide |
|---|---|
| PubChem CID | 19060941 |
| Molecular Formula | C17H18BrN3O |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-[(E)-[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)N/N=C/c1ccc(N(C)C)c(Br)c1 |
| InChI | InChI=1S/C17H18BrN3O/c1-12-6-4-5-7-14(12)17(22)20-19-11-13-8-9-16(21(2)3)15(18)10-13/h4-11H,1-3H3,(H,20,22)/b19-11+ |
| InChIKey | YEDIZFRVKIFVJQ-YBFXNURJSA-N |
| XLogP | 3.59 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|