C18H20BrN3O2 — CID 17246243
N-[(E)-[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-4-ethoxybenzamide (PubChem CID 17246243) has the molecular formula C18H20BrN3O2 and a molecular weight of 390.28 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-4-ethoxybenzamide.
| Compound Name | N-[(E)-[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 17246243 |
| Molecular Formula | C18H20BrN3O2 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | N-[(E)-[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2ccc(N(C)C)c(Br)c2)cc1 |
| InChI | InChI=1S/C18H20BrN3O2/c1-4-24-15-8-6-14(7-9-15)18(23)21-20-12-13-5-10-17(22(2)3)16(19)11-13/h5-12H,4H2,1-3H3,(H,21,23)/b20-12+ |
| InChIKey | RYDZACRSAVUIKV-UDWIEESQSA-N |
| XLogP | 3.68 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|