C16H15BrN4O3 — CID 9016525
2-bromo-N-[(Z)-[4-(dimethylamino)-3-nitrophenyl]methylideneamino]benzamide (PubChem CID 9016525) has the molecular formula C16H15BrN4O3 and a molecular weight of 391.23 g/mol. Its IUPAC name is 2-bromo-N-[(Z)-[4-(dimethylamino)-3-nitrophenyl]methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(Z)-[4-(dimethylamino)-3-nitrophenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 9016525 |
| Molecular Formula | C16H15BrN4O3 |
| Molecular Weight | 391.23 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 2-bromo-N-[(Z)-[4-(dimethylamino)-3-nitrophenyl]methylideneamino]benzamide |
| SMILES | CN(C)c1ccc(/C=N\NC(=O)c2ccccc2Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15BrN4O3/c1-20(2)14-8-7-11(9-15(14)21(23)24)10-18-19-16(22)12-5-3-4-6-13(12)17/h3-10H,1-2H3,(H,19,22)/b18-10- |
| InChIKey | NQEFFNFCMBGVTE-ZDLGFXPLSA-N |
| XLogP | 3.19 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|