C10H12N6O — CID 135439758
2-[(E)-[(4-amino-5-methyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]phenol (PubChem CID 135439758) has the molecular formula C10H12N6O and a molecular weight of 232.25 g/mol. Its IUPAC name is 2-[(E)-[(4-amino-5-methyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2-[(E)-[(4-amino-5-methyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135439758 |
| Molecular Formula | C10H12N6O |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 2-[(E)-[(4-amino-5-methyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]phenol |
| SMILES | Cc1nnc(N/N=C/c2ccccc2O)n1N |
| InChI | InChI=1S/C10H12N6O/c1-7-13-15-10(16(7)11)14-12-6-8-4-2-3-5-9(8)17/h2-6,17H,11H2,1H3,(H,14,15)/b12-6+ |
| InChIKey | BNPPVFAWKXLHMM-WUXMJOGZSA-N |
| XLogP | 0.45 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|