C13H9BrN4O4 — CID 126100153
N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-3-nitropyridin-2-amine (PubChem CID 126100153) has the molecular formula C13H9BrN4O4 and a molecular weight of 365.14 g/mol. Its IUPAC name is N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-3-nitropyridin-2-amine.
| Compound Name | N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 126100153 |
| Molecular Formula | C13H9BrN4O4 |
| Molecular Weight | 365.14 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-3-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1cccnc1N/N=C/c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C13H9BrN4O4/c14-9-5-12-11(21-7-22-12)4-8(9)6-16-17-13-10(18(19)20)2-1-3-15-13/h1-6H,7H2,(H,15,17)/b16-6+ |
| InChIKey | AAXYTFDXESDJOV-OMCISZLKSA-N |
| XLogP | 2.93 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.14 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|