C18H16BrN5O2 — CID 126107569
N-[(E)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-nitropyridin-2-amine (PubChem CID 126107569) has the molecular formula C18H16BrN5O2 and a molecular weight of 414.26 g/mol. Its IUPAC name is N-[(E)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-nitropyridin-2-amine.
| Compound Name | N-[(E)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 126107569 |
| Molecular Formula | C18H16BrN5O2 |
| Molecular Weight | 414.26 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | N-[(E)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-nitropyridin-2-amine |
| SMILES | Cc1cc(/C=N/Nc2ncccc2[N+](=O)[O-])c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H16BrN5O2/c1-12-10-14(13(2)23(12)16-7-5-15(19)6-8-16)11-21-22-18-17(24(25)26)4-3-9-20-18/h3-11H,1-2H3,(H,20,22)/b21-11+ |
| InChIKey | WJUAEERPYFHBEP-SRZZPIQSSA-N |
| XLogP | 4.61 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.26 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|