C15H8BrClF3NO2 — CID 171982695
N-[4-bromo-3-(trifluoromethyl)phenyl]-1-(6-chloro-1,3-benzodioxol-5-yl)methanimine (PubChem CID 171982695) has the molecular formula C15H8BrClF3NO2 and a molecular weight of 406.59 g/mol. Its IUPAC name is N-[4-bromo-3-(trifluoromethyl)phenyl]-1-(6-chloro-1,3-benzodioxol-5-yl)methanimine.
| Compound Name | N-[4-bromo-3-(trifluoromethyl)phenyl]-1-(6-chloro-1,3-benzodioxol-5-yl)methanimine |
|---|---|
| PubChem CID | 171982695 |
| Molecular Formula | C15H8BrClF3NO2 |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 404.94 |
| IUPAC Name | N-[4-bromo-3-(trifluoromethyl)phenyl]-1-(6-chloro-1,3-benzodioxol-5-yl)methanimine |
| SMILES | FC(F)(F)c1cc(/N=C/c2cc3c(cc2Cl)OCO3)ccc1Br |
| InChI | InChI=1S/C15H8BrClF3NO2/c16-11-2-1-9(4-10(11)15(18,19)20)21-6-8-3-13-14(5-12(8)17)23-7-22-13/h1-6H,7H2/b21-6+ |
| InChIKey | SYNJEGHLLMGPHQ-AERZKKPOSA-N |
| XLogP | 5.60 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|