C24H16Br2N2O6 — CID 159744693
6-bromo-1,3-benzodioxole-5-carbaldehyde;5-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1,3-dihydroindol-2-one (PubChem CID 159744693) has the molecular formula C24H16Br2N2O6 and a molecular weight of 588.21 g/mol. Its IUPAC name is 6-bromo-1,3-benzodioxole-5-carbaldehyde;5-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1,3-dihydroindol-2-one.
| Compound Name | 6-bromo-1,3-benzodioxole-5-carbaldehyde;5-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 159744693 |
| Molecular Formula | C24H16Br2N2O6 |
| Molecular Weight | 588.21 g/mol |
| Exact Mass | 585.94 |
| IUPAC Name | 6-bromo-1,3-benzodioxole-5-carbaldehyde;5-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(/N=C/c3cc4c(cc3Br)OCO4)ccc2N1.O=Cc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C16H11BrN2O3.C8H5BrO3/c17-12-6-15-14(21-8-22-15)4-10(12)7-18-11-1-2-13-9(3-11)5-16(20)19-13;9-6-2-8-7(11-4-12-8)1-5(6)3-10/h1-4,6-7H,5,8H2,(H,19,20);1-3H,4H2/b18-7+; |
| InChIKey | NCWZCYIZSFSBQF-CWSPIBBISA-N |
| XLogP | 5.41 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.21 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|