C16H9Br2NO3 — CID 26366473
(3Z)-5-bromo-3-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1H-indol-2-one (PubChem CID 26366473) has the molecular formula C16H9Br2NO3 and a molecular weight of 423.06 g/mol. Its IUPAC name is (3Z)-5-bromo-3-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-5-bromo-3-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 26366473 |
| Molecular Formula | C16H9Br2NO3 |
| Molecular Weight | 423.06 g/mol |
| Exact Mass | 420.89 |
| IUPAC Name | (3Z)-5-bromo-3-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(Br)cc2/C1=C/c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C16H9Br2NO3/c17-9-1-2-13-10(5-9)11(16(20)19-13)3-8-4-14-15(6-12(8)18)22-7-21-14/h1-6H,7H2,(H,19,20)/b11-3- |
| InChIKey | KONXWPINUVHQTG-JYOAFUTRSA-N |
| XLogP | 4.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.06 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|