C9H7Cr2NO5 — CID 158929871
bis(chromium(3+));2-oxo-1,3-dihydroindole-5-carbaldehyde;tris(oxygen(2-)) (PubChem CID 158929871) has the molecular formula C9H7Cr2NO5 and a molecular weight of 313.15 g/mol. Its IUPAC name is bis(chromium(3+));2-oxo-1,3-dihydroindole-5-carbaldehyde;tris(oxygen(2-)).
| Compound Name | bis(chromium(3+));2-oxo-1,3-dihydroindole-5-carbaldehyde;tris(oxygen(2-)) |
|---|---|
| PubChem CID | 158929871 |
| Molecular Formula | C9H7Cr2NO5 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.91 |
| IUPAC Name | bis(chromium(3+));2-oxo-1,3-dihydroindole-5-carbaldehyde;tris(oxygen(2-)) |
| SMILES | O=Cc1ccc2c(c1)CC(=O)N2.[Cr+3].[Cr+3].[O-2].[O-2].[O-2] |
| InChI | InChI=1S/C9H7NO2.2Cr.3O/c11-5-6-1-2-8-7(3-6)4-9(12)10-8;;;;;/h1-3,5H,4H2,(H,10,12);;;;;/q;2*+3;3*-2 |
| InChIKey | VGBYGIYEDJAIJE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 131.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|