C11H8N2O — CID 169483632
3-(2-oxo-1,3-dihydroindol-5-yl)prop-2-enenitrile (PubChem CID 169483632) has the molecular formula C11H8N2O and a molecular weight of 184.20 g/mol. Its IUPAC name is 3-(2-oxo-1,3-dihydroindol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(2-oxo-1,3-dihydroindol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169483632 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 3-(2-oxo-1,3-dihydroindol-5-yl)prop-2-enenitrile |
| SMILES | N#CC=Cc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C11H8N2O/c12-5-1-2-8-3-4-10-9(6-8)7-11(14)13-10/h1-4,6H,7H2,(H,13,14) |
| InChIKey | BTFGPPCHLGRTPY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|