C7H8NO5P — CID 118959209
(6-amino-1,3-benzodioxol-5-yl)phosphonic acid (PubChem CID 118959209) has the molecular formula C7H8NO5P and a molecular weight of 217.12 g/mol. Its IUPAC name is (6-amino-1,3-benzodioxol-5-yl)phosphonic acid.
| Compound Name | (6-amino-1,3-benzodioxol-5-yl)phosphonic acid |
|---|---|
| PubChem CID | 118959209 |
| Molecular Formula | C7H8NO5P |
| Molecular Weight | 217.12 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | (6-amino-1,3-benzodioxol-5-yl)phosphonic acid |
| SMILES | Nc1cc2c(cc1P(=O)(O)O)OCO2 |
| InChI | InChI=1S/C7H8NO5P/c8-4-1-5-6(13-3-12-5)2-7(4)14(9,10)11/h1-2H,3,8H2,(H2,9,10,11) |
| InChIKey | SPBQAUSSHNOYIG-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.12 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|