C9H8BrNO3 — CID 139571740
1-(6-amino-1,3-benzodioxol-5-yl)-2-bromoethanone (PubChem CID 139571740) has the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. Its IUPAC name is 1-(6-amino-1,3-benzodioxol-5-yl)-2-bromoethanone.
| Compound Name | 1-(6-amino-1,3-benzodioxol-5-yl)-2-bromoethanone |
|---|---|
| PubChem CID | 139571740 |
| Molecular Formula | C9H8BrNO3 |
| Molecular Weight | 258.07 g/mol |
| Exact Mass | 256.97 |
| IUPAC Name | 1-(6-amino-1,3-benzodioxol-5-yl)-2-bromoethanone |
| SMILES | Nc1cc2c(cc1C(=O)CBr)OCO2 |
| InChI | InChI=1S/C9H8BrNO3/c10-3-7(12)5-1-8-9(2-6(5)11)14-4-13-8/h1-2H,3-4,11H2 |
| InChIKey | UTFVLSSIBIFAKZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.07 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|