C11H12F2N2O3 — CID 103543443
6-amino-N-(2,2-difluoroethyl)-N-methyl-1,3-benzodioxole-5-carboxamide (PubChem CID 103543443) has the molecular formula C11H12F2N2O3 and a molecular weight of 258.22 g/mol. Its IUPAC name is 6-amino-N-(2,2-difluoroethyl)-N-methyl-1,3-benzodioxole-5-carboxamide.
| Compound Name | 6-amino-N-(2,2-difluoroethyl)-N-methyl-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 103543443 |
| Molecular Formula | C11H12F2N2O3 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 6-amino-N-(2,2-difluoroethyl)-N-methyl-1,3-benzodioxole-5-carboxamide |
| SMILES | CN(CC(F)F)C(=O)c1cc2c(cc1N)OCO2 |
| InChI | InChI=1S/C11H12F2N2O3/c1-15(4-10(12)13)11(16)6-2-8-9(3-7(6)14)18-5-17-8/h2-3,10H,4-5,14H2,1H3 |
| InChIKey | XXEKCJZUQYEDMX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|