C11H15ClF2N2O — CID 120626074
5-amino-N-(2,2-difluoroethyl)-N,2-dimethylbenzamide;hydrochloride (PubChem CID 120626074) has the molecular formula C11H15ClF2N2O and a molecular weight of 264.70 g/mol. Its IUPAC name is 5-amino-N-(2,2-difluoroethyl)-N,2-dimethylbenzamide;hydrochloride.
| Compound Name | 5-amino-N-(2,2-difluoroethyl)-N,2-dimethylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 120626074 |
| Molecular Formula | C11H15ClF2N2O |
| Molecular Weight | 264.70 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 5-amino-N-(2,2-difluoroethyl)-N,2-dimethylbenzamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)N(C)CC(F)F.Cl |
| InChI | InChI=1S/C11H14F2N2O.ClH/c1-7-3-4-8(14)5-9(7)11(16)15(2)6-10(12)13;/h3-5,10H,6,14H2,1-2H3;1H |
| InChIKey | OCLDFZMZRPWZFO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.70 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|