C20H27ClN2O — CID 120636434
5-amino-N,2-dimethyl-N-[2-methyl-2-(4-methylphenyl)propyl]benzamide;hydrochloride (PubChem CID 120636434) has the molecular formula C20H27ClN2O and a molecular weight of 346.90 g/mol. Its IUPAC name is 5-amino-N,2-dimethyl-N-[2-methyl-2-(4-methylphenyl)propyl]benzamide;hydrochloride.
| Compound Name | 5-amino-N,2-dimethyl-N-[2-methyl-2-(4-methylphenyl)propyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120636434 |
| Molecular Formula | C20H27ClN2O |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 5-amino-N,2-dimethyl-N-[2-methyl-2-(4-methylphenyl)propyl]benzamide;hydrochloride |
| SMILES | Cc1ccc(C(C)(C)CN(C)C(=O)c2cc(N)ccc2C)cc1.Cl |
| InChI | InChI=1S/C20H26N2O.ClH/c1-14-6-9-16(10-7-14)20(3,4)13-22(5)19(23)18-12-17(21)11-8-15(18)2;/h6-12H,13,21H2,1-5H3;1H |
| InChIKey | UNNBHDTVZXMYAN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|